Disperse Blue 60 CAS# 12217-80-0
| Disperse Blue 60 Basic information |
| Product Name: |
Disperse Blue 60 |
| Synonyms: |
DISPERSE BLUE 60;1H-Naphth2,3-fisoindole-1,3,5,10(2H)-tetrone, 4,11-diamino-2-(3-methoxypropyl)-;4,11-diamino-2-(3-methoxypropyl)-1h-naphth[2,3-f]isoindole-1,3,5,10(2h)-tetrone;Disperse Turquoise Blue GL;4,11-diamino-2-(3-methoxypropyl)-1H-naphth[2,3-f]isoindol-1,3,5,10(2H)-tetrone;DISPERSE BLUE S-GL;Disperse blue 60 (C.I. 61104);Turq Blue HGL |
| CAS: |
12217-80-0 |
| MF: |
C20H17N3O5 |
| MW: |
379.37 |
| EINECS: |
235-402-7 |
| Product Categories: |
Dyes and Pigments |
| Mol File: |
12217-80-0.mol |
 |
|
| Disperse Blue 60 Chemical Properties |
| Boiling point |
677.5±55.0 °C(Predicted) |
| density |
1.495±0.06 g/cm3(Predicted) |
| vapor pressure |
0Pa at 25℃ |
| solubility |
121 in mg/100g standard fat at 20 ℃ |
| pka |
-2.28±0.20(Predicted) |
| form |
Solid |
| color |
Dark Blue to Very Dark Blue |
| Water Solubility |
2.5μg/L at 20℃ |
| InChI |
InChI=1S/C20H17N3O5/c1-28-8-4-7-23-19(26)13-14(20(23)27)16(22)12-11(15(13)21)17(24)9-5-2-3-6-10(9)18(12)25/h2-3,5-6H,4,7-8,21-22H2,1H3 |
| InChIKey |
WBCXRDHKXHADQF-UHFFFAOYSA-N |
| SMILES |
C1(=O)C2=C(C(N)=C3C(=O)C4=C(C=CC=C4)C(=O)C3=C2N)C(=O)N1CCCOC |
| LogP |
4.2 at 20℃ |
| CAS DataBase Reference |
12217-80-0(CAS DataBase Reference) |
| EPA Substance Registry System |
C.I. Disperse Blue 60 (12217-80-0) |
|
| Disperse Blue 60 Usage And Synthesis |
| Uses |
Disperse Blue 60 is an anthraquinone blue dyes. |
| Preparation |
1,4-Diaminoanthraquinone chlorinated, stlfonation, cyanide, dehydrated, closed loop, And then?condensation?of 3-Methoxypropan-1-amine. |
| Flammability and Explosibility |
Non flammable |
| Properties and Applications |
colourful green light blue. Blue powder, soluble in acetone. In dye bath of iron ion in that dark colored. Dye bath appropriate pH value for 3 ~ 5, in dyeing and printing not alkali resistance. The dye for green light blue emerald green light, in the dying as the colourful dye, dye deep sex general, to give priority to with light color, and the fastness passable, have good fastness and dry hot sun fastness, suitable for high temperature and high pressure melt method, carrier dyeing of general performance. In three vinegar on fiber dyeing, colored light and polyester similar. Can be used for polyester/cotton blended fabric printing directly, cannot be used as printing the impression of the discharge.
| Standard |
Ironing Fastness |
Light Fastness |
Persperation Fastness |
Washing Fastness |
| Fading |
Stain |
Fading |
Stain |
Fading |
Stain |
| ISO |
4-5 |
3-4 |
7 |
5 |
5 |
4-5 |
4-5 |
| AATCC |
|
|
7-8 |
4-5 |
5 |
4-5 |
5 |
|
评价
目前还没有评价